C16H10F2N2 — CID 107919059
1-[(2,4-difluorophenyl)methyl]indole-4-carbonitrile (PubChem CID 107919059) has the molecular formula C16H10F2N2 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]indole-4-carbonitrile.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]indole-4-carbonitrile |
|---|---|
| PubChem CID | 107919059 |
| Molecular Formula | C16H10F2N2 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]indole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1ccn2Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H10F2N2/c17-13-5-4-12(15(18)8-13)10-20-7-6-14-11(9-19)2-1-3-16(14)20/h1-8H,10H2 |
| InChIKey | SXKWXFLYEXQIBR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |