C14H10ClF2N3 — CID 104837124
4-chloro-1-[(2,5-difluorophenyl)methyl]benzimidazol-2-amine (PubChem CID 104837124) has the molecular formula C14H10ClF2N3 and a molecular weight of 293.70 g/mol. Its IUPAC name is 4-chloro-1-[(2,5-difluorophenyl)methyl]benzimidazol-2-amine.
| Compound Name | 4-chloro-1-[(2,5-difluorophenyl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 104837124 |
| Molecular Formula | C14H10ClF2N3 |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-chloro-1-[(2,5-difluorophenyl)methyl]benzimidazol-2-amine |
| SMILES | Nc1nc2c(Cl)cccc2n1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C14H10ClF2N3/c15-10-2-1-3-12-13(10)19-14(18)20(12)7-8-6-9(16)4-5-11(8)17/h1-6H,7H2,(H2,18,19) |
| InChIKey | SVERRIQTEXGBAN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |