C10H8ClF4N3 — CID 106294645
4-chloro-1-(2,2,3,3-tetrafluoropropyl)benzimidazol-2-amine (PubChem CID 106294645) has the molecular formula C10H8ClF4N3 and a molecular weight of 281.64 g/mol. Its IUPAC name is 4-chloro-1-(2,2,3,3-tetrafluoropropyl)benzimidazol-2-amine.
| Compound Name | 4-chloro-1-(2,2,3,3-tetrafluoropropyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 106294645 |
| Molecular Formula | C10H8ClF4N3 |
| Molecular Weight | 281.64 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-chloro-1-(2,2,3,3-tetrafluoropropyl)benzimidazol-2-amine |
| SMILES | Nc1nc2c(Cl)cccc2n1CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H8ClF4N3/c11-5-2-1-3-6-7(5)17-9(16)18(6)4-10(14,15)8(12)13/h1-3,8H,4H2,(H2,16,17) |
| InChIKey | UBCLVXDJVFYQHN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|