C14H7F3N4 — CID 104718729
2-amino-1-(2,3,4-trifluorophenyl)benzimidazole-4-carbonitrile (PubChem CID 104718729) has the molecular formula C14H7F3N4 and a molecular weight of 288.23 g/mol. Its IUPAC name is 2-amino-1-(2,3,4-trifluorophenyl)benzimidazole-4-carbonitrile.
| Compound Name | 2-amino-1-(2,3,4-trifluorophenyl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718729 |
| Molecular Formula | C14H7F3N4 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-amino-1-(2,3,4-trifluorophenyl)benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1nc(N)n2-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H7F3N4/c15-8-4-5-9(12(17)11(8)16)21-10-3-1-2-7(6-18)13(10)20-14(21)19/h1-5H,(H2,19,20) |
| InChIKey | FSJDSRHAJFFHBW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|