C13H8Cl2FN3 — CID 60790457
1-(3,4-dichlorophenyl)-4-fluorobenzimidazol-2-amine (PubChem CID 60790457) has the molecular formula C13H8Cl2FN3 and a molecular weight of 296.13 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-fluorobenzimidazol-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-4-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 60790457 |
| Molecular Formula | C13H8Cl2FN3 |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-fluorobenzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cccc2n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2FN3/c14-8-5-4-7(6-9(8)15)19-11-3-1-2-10(16)12(11)18-13(19)17/h1-6H,(H2,17,18) |
| InChIKey | FSNRSDBCBWDGKM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |