C16H12ClN3S — CID 104718269
1-[1-(2-chlorophenyl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile (PubChem CID 104718269) has the molecular formula C16H12ClN3S and a molecular weight of 313.81 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718269 |
| Molecular Formula | C16H12ClN3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-2-sulfanylidene-3H-benzimidazole-4-carbonitrile |
| SMILES | CC(c1ccccc1Cl)n1c(=S)[nH]c2c(C#N)cccc21 |
| InChI | InChI=1S/C16H12ClN3S/c1-10(12-6-2-3-7-13(12)17)20-14-8-4-5-11(9-18)15(14)19-16(20)21/h2-8,10H,1H3,(H,19,21) |
| InChIKey | LMEAYYMXIJFDTN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|