C14H9ClN2O2S — CID 4775290
3-(5-chloro-2-hydroxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4775290) has the molecular formula C14H9ClN2O2S and a molecular weight of 304.76 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4775290 |
| Molecular Formula | C14H9ClN2O2S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1-c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H9ClN2O2S/c15-8-5-6-12(18)11(7-8)17-13(19)9-3-1-2-4-10(9)16-14(17)20/h1-7,18H,(H,16,20) |
| InChIKey | YPZLOUURGJFZGQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|