C14H7Cl3N2OS — CID 11501326
6,8-dichloro-3-(2-chlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 11501326) has the molecular formula C14H7Cl3N2OS and a molecular weight of 357.65 g/mol. Its IUPAC name is 6,8-dichloro-3-(2-chlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6,8-dichloro-3-(2-chlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 11501326 |
| Molecular Formula | C14H7Cl3N2OS |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 6,8-dichloro-3-(2-chlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2cc(Cl)cc(Cl)c2[nH]c(=S)n1-c1ccccc1Cl |
| InChI | InChI=1S/C14H7Cl3N2OS/c15-7-5-8-12(10(17)6-7)18-14(21)19(13(8)20)11-4-2-1-3-9(11)16/h1-6H,(H,18,21) |
| InChIKey | VUUCCJNGZAJIAR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|