C16H10Cl2N2O2S — CID 4771734
6,8-dichloro-3-(4-methylbenzoyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4771734) has the molecular formula C16H10Cl2N2O2S and a molecular weight of 365.24 g/mol. Its IUPAC name is 6,8-dichloro-3-(4-methylbenzoyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6,8-dichloro-3-(4-methylbenzoyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4771734 |
| Molecular Formula | C16H10Cl2N2O2S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 6,8-dichloro-3-(4-methylbenzoyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | Cc1ccc(C(=O)n2c(=S)[nH]c3c(Cl)cc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C16H10Cl2N2O2S/c1-8-2-4-9(5-3-8)14(21)20-15(22)11-6-10(17)7-12(18)13(11)19-16(20)23/h2-7H,1H3,(H,19,23) |
| InChIKey | SHIOITSZMADUCG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|