C14H10Cl2N2OS2 — CID 43396148
3-(2,4-dichlorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 43396148) has the molecular formula C14H10Cl2N2OS2 and a molecular weight of 357.29 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2,4-dichlorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 43396148 |
| Molecular Formula | C14H10Cl2N2OS2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2[nH]c(=S)n(-c3ccc(Cl)cc3Cl)c(=O)c2c1C |
| InChI | InChI=1S/C14H10Cl2N2OS2/c1-6-7(2)21-12-11(6)13(19)18(14(20)17-12)10-4-3-8(15)5-9(10)16/h3-5H,1-2H3,(H,17,20) |
| InChIKey | RMQHCAZXCPRBKD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|