C14H10BrFN2OS2 — CID 104780007
3-(3-bromo-4-fluorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 104780007) has the molecular formula C14H10BrFN2OS2 and a molecular weight of 385.28 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3-bromo-4-fluorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 104780007 |
| Molecular Formula | C14H10BrFN2OS2 |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 3-(3-bromo-4-fluorophenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2[nH]c(=S)n(-c3ccc(F)c(Br)c3)c(=O)c2c1C |
| InChI | InChI=1S/C14H10BrFN2OS2/c1-6-7(2)21-12-11(6)13(19)18(14(20)17-12)8-3-4-10(16)9(15)5-8/h3-5H,1-2H3,(H,17,20) |
| InChIKey | YTKSYBOPXQNUHE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|