C13H14BrFN2S — CID 104780243
3-(3-bromo-4-fluorophenyl)-4-tert-butyl-1H-imidazole-2-thione (PubChem CID 104780243) has the molecular formula C13H14BrFN2S and a molecular weight of 329.24 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenyl)-4-tert-butyl-1H-imidazole-2-thione.
| Compound Name | 3-(3-bromo-4-fluorophenyl)-4-tert-butyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 104780243 |
| Molecular Formula | C13H14BrFN2S |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 3-(3-bromo-4-fluorophenyl)-4-tert-butyl-1H-imidazole-2-thione |
| SMILES | CC(C)(C)c1c[nH]c(=S)n1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H14BrFN2S/c1-13(2,3)11-7-16-12(18)17(11)8-4-5-10(15)9(14)6-8/h4-7H,1-3H3,(H,16,18) |
| InChIKey | KMGIGUHIMYZHGF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|