C14H14F4N2S — CID 81338926
4-tert-butyl-3-[2-fluoro-5-(trifluoromethyl)phenyl]-1H-imidazole-2-thione (PubChem CID 81338926) has the molecular formula C14H14F4N2S and a molecular weight of 318.34 g/mol. Its IUPAC name is 4-tert-butyl-3-[2-fluoro-5-(trifluoromethyl)phenyl]-1H-imidazole-2-thione.
| Compound Name | 4-tert-butyl-3-[2-fluoro-5-(trifluoromethyl)phenyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81338926 |
| Molecular Formula | C14H14F4N2S |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-tert-butyl-3-[2-fluoro-5-(trifluoromethyl)phenyl]-1H-imidazole-2-thione |
| SMILES | CC(C)(C)c1c[nH]c(=S)n1-c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C14H14F4N2S/c1-13(2,3)11-7-19-12(21)20(11)10-6-8(14(16,17)18)4-5-9(10)15/h4-7H,1-3H3,(H,19,21) |
| InChIKey | BVGNMIUWVDLSSD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|