C16H10N4OS2 — CID 135017548
3-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 135017548) has the molecular formula C16H10N4OS2 and a molecular weight of 338.42 g/mol. Its IUPAC name is 3-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 135017548 |
| Molecular Formula | C16H10N4OS2 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 3-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1-c1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H10N4OS2/c21-14-11-8-4-5-9-12(11)17-15(22)20(14)16-19-18-13(23-16)10-6-2-1-3-7-10/h1-9H,(H,17,22) |
| InChIKey | DAGUHBRBKKWXJH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|