C14H12N4O2 — CID 21275141
7-amino-3-(2-aminophenyl)-1H-quinazoline-2,4-dione (PubChem CID 21275141) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 7-amino-3-(2-aminophenyl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-amino-3-(2-aminophenyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 21275141 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 7-amino-3-(2-aminophenyl)-1H-quinazoline-2,4-dione |
| SMILES | Nc1ccc2c(=O)n(-c3ccccc3N)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H12N4O2/c15-8-5-6-9-11(7-8)17-14(20)18(13(9)19)12-4-2-1-3-10(12)16/h1-7H,15-16H2,(H,17,20) |
| InChIKey | FSQOYUYUEXAWCN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 106.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|