C25H18N2O2 — CID 175627260
7-(2-methylphenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione (PubChem CID 175627260) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 7-(2-methylphenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione.
| Compound Name | 7-(2-methylphenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 175627260 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 7-(2-methylphenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
| SMILES | Cc1ccccc1-c1ccc2c(=O)n(-c3cccc4ccccc34)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C25H18N2O2/c1-16-7-2-4-10-19(16)18-13-14-21-22(15-18)26-25(29)27(24(21)28)23-12-6-9-17-8-3-5-11-20(17)23/h2-15H,1H3,(H,26,29) |
| InChIKey | AUCWZFBMSAPAEA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |