C27H17N3O2 — CID 170773945
3-isoquinolin-4-yl-7-naphthalen-2-yl-1H-quinazoline-2,4-dione (PubChem CID 170773945) has the molecular formula C27H17N3O2 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-isoquinolin-4-yl-7-naphthalen-2-yl-1H-quinazoline-2,4-dione.
| Compound Name | 3-isoquinolin-4-yl-7-naphthalen-2-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 170773945 |
| Molecular Formula | C27H17N3O2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-isoquinolin-4-yl-7-naphthalen-2-yl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(-c3ccc4ccccc4c3)ccc2c(=O)n1-c1cncc2ccccc12 |
| InChI | InChI=1S/C27H17N3O2/c31-26-23-12-11-20(19-10-9-17-5-1-2-6-18(17)13-19)14-24(23)29-27(32)30(26)25-16-28-15-21-7-3-4-8-22(21)25/h1-16H,(H,29,32) |
| InChIKey | KOIPPLBGGGGGTG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |