C19H13F2N3O2 — CID 166085752
6-(1,1-difluoroethyl)-3-isoquinolin-4-yl-1H-quinazoline-2,4-dione (PubChem CID 166085752) has the molecular formula C19H13F2N3O2 and a molecular weight of 353.33 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-3-isoquinolin-4-yl-1H-quinazoline-2,4-dione.
| Compound Name | 6-(1,1-difluoroethyl)-3-isoquinolin-4-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 166085752 |
| Molecular Formula | C19H13F2N3O2 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 6-(1,1-difluoroethyl)-3-isoquinolin-4-yl-1H-quinazoline-2,4-dione |
| SMILES | CC(F)(F)c1ccc2[nH]c(=O)n(-c3cncc4ccccc34)c(=O)c2c1 |
| InChI | InChI=1S/C19H13F2N3O2/c1-19(20,21)12-6-7-15-14(8-12)17(25)24(18(26)23-15)16-10-22-9-11-4-2-3-5-13(11)16/h2-10H,1H3,(H,23,26) |
| InChIKey | FOVNQGXUVAIEEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |