C22H17F3N4O4 — CID 166085876
4-[2,4-dioxo-6-(trifluoromethyl)-1H-quinazolin-3-yl]-N-(2-methoxyethyl)isoquinoline-6-carboxamide (PubChem CID 166085876) has the molecular formula C22H17F3N4O4 and a molecular weight of 458.40 g/mol. Its IUPAC name is 4-[2,4-dioxo-6-(trifluoromethyl)-1H-quinazolin-3-yl]-N-(2-methoxyethyl)isoquinoline-6-carboxamide.
| Compound Name | 4-[2,4-dioxo-6-(trifluoromethyl)-1H-quinazolin-3-yl]-N-(2-methoxyethyl)isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 166085876 |
| Molecular Formula | C22H17F3N4O4 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-[2,4-dioxo-6-(trifluoromethyl)-1H-quinazolin-3-yl]-N-(2-methoxyethyl)isoquinoline-6-carboxamide |
| SMILES | COCCNC(=O)c1ccc2cncc(-n3c(=O)[nH]c4ccc(C(F)(F)F)cc4c3=O)c2c1 |
| InChI | InChI=1S/C22H17F3N4O4/c1-33-7-6-27-19(30)12-2-3-13-10-26-11-18(15(13)8-12)29-20(31)16-9-14(22(23,24)25)4-5-17(16)28-21(29)32/h2-5,8-11H,6-7H2,1H3,(H,27,30)(H,28,32) |
| InChIKey | ZVCPIZYILIJBEH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|