C21H26N4O3 — CID 70801495
3-(3-tert-butyl-2-oxo-1H-imidazo[4,5-b]pyridin-6-yl)-N-(2-methoxyethyl)-4-methylbenzamide (PubChem CID 70801495) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(3-tert-butyl-2-oxo-1H-imidazo[4,5-b]pyridin-6-yl)-N-(2-methoxyethyl)-4-methylbenzamide.
| Compound Name | 3-(3-tert-butyl-2-oxo-1H-imidazo[4,5-b]pyridin-6-yl)-N-(2-methoxyethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 70801495 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3-(3-tert-butyl-2-oxo-1H-imidazo[4,5-b]pyridin-6-yl)-N-(2-methoxyethyl)-4-methylbenzamide |
| SMILES | COCCNC(=O)c1ccc(C)c(-c2cnc3c(c2)[nH]c(=O)n3C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26N4O3/c1-13-6-7-14(19(26)22-8-9-28-5)10-16(13)15-11-17-18(23-12-15)25(20(27)24-17)21(2,3)4/h6-7,10-12H,8-9H2,1-5H3,(H,22,26)(H,24,27) |
| InChIKey | RXQXSEPYJBBBMP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|