C30H19ClN2O2 — CID 175627336
7-[2-(2-chlorophenyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione (PubChem CID 175627336) has the molecular formula C30H19ClN2O2 and a molecular weight of 474.95 g/mol. Its IUPAC name is 7-[2-(2-chlorophenyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione.
| Compound Name | 7-[2-(2-chlorophenyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 175627336 |
| Molecular Formula | C30H19ClN2O2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 7-[2-(2-chlorophenyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(-c3ccccc3-c3ccccc3Cl)ccc2c(=O)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C30H19ClN2O2/c31-26-14-6-5-13-24(26)23-12-4-3-10-21(23)20-16-17-25-27(18-20)32-30(35)33(29(25)34)28-15-7-9-19-8-1-2-11-22(19)28/h1-18H,(H,32,35) |
| InChIKey | QEXOACGHEABWHY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |