C25H15N3O2 — CID 175627262
3-(3-naphthalen-1-yl-2,4-dioxo-1H-quinazolin-7-yl)benzonitrile (PubChem CID 175627262) has the molecular formula C25H15N3O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(3-naphthalen-1-yl-2,4-dioxo-1H-quinazolin-7-yl)benzonitrile.
| Compound Name | 3-(3-naphthalen-1-yl-2,4-dioxo-1H-quinazolin-7-yl)benzonitrile |
|---|---|
| PubChem CID | 175627262 |
| Molecular Formula | C25H15N3O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-(3-naphthalen-1-yl-2,4-dioxo-1H-quinazolin-7-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c(=O)n(-c4cccc5ccccc45)c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C25H15N3O2/c26-15-16-5-3-8-18(13-16)19-11-12-21-22(14-19)27-25(30)28(24(21)29)23-10-4-7-17-6-1-2-9-20(17)23/h1-14H,(H,27,30) |
| InChIKey | RVIOSBBNENUATH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |