C24H14Cl2N2O2 — CID 175627384
7-(2,6-dichlorophenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione (PubChem CID 175627384) has the molecular formula C24H14Cl2N2O2 and a molecular weight of 433.29 g/mol. Its IUPAC name is 7-(2,6-dichlorophenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione.
| Compound Name | 7-(2,6-dichlorophenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 175627384 |
| Molecular Formula | C24H14Cl2N2O2 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 7-(2,6-dichlorophenyl)-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(-c3c(Cl)cccc3Cl)ccc2c(=O)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C24H14Cl2N2O2/c25-18-8-4-9-19(26)22(18)15-11-12-17-20(13-15)27-24(30)28(23(17)29)21-10-3-6-14-5-1-2-7-16(14)21/h1-13H,(H,27,30) |
| InChIKey | SESZJNKLXCFSKZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |