C25H16F2N2O2 — CID 175627281
7-[2-(difluoromethyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione (PubChem CID 175627281) has the molecular formula C25H16F2N2O2 and a molecular weight of 414.41 g/mol. Its IUPAC name is 7-[2-(difluoromethyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione.
| Compound Name | 7-[2-(difluoromethyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 175627281 |
| Molecular Formula | C25H16F2N2O2 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 7-[2-(difluoromethyl)phenyl]-3-naphthalen-1-yl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(-c3ccccc3C(F)F)ccc2c(=O)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C25H16F2N2O2/c26-23(27)19-10-4-3-8-17(19)16-12-13-20-21(14-16)28-25(31)29(24(20)30)22-11-5-7-15-6-1-2-9-18(15)22/h1-14,23H,(H,28,31) |
| InChIKey | BYLCCWIXWQLHJX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |