C20H17N5O3S — CID 136782951
(4S)-4-[(2-hydroxyphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one (PubChem CID 136782951) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is (4S)-4-[(2-hydroxyphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one.
| Compound Name | (4S)-4-[(2-hydroxyphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 136782951 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (4S)-4-[(2-hydroxyphenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one |
| SMILES | COc1ccc(-c2csc(N3N=C(C)[C@H](/N=N/c4ccccc4O)C3=O)n2)cc1 |
| InChI | InChI=1S/C20H17N5O3S/c1-12-18(23-22-15-5-3-4-6-17(15)26)19(27)25(24-12)20-21-16(11-29-20)13-7-9-14(28-2)10-8-13/h3-11,18,26H,1-2H3/b23-22+/t18-/m0/s1 |
| InChIKey | WZDJYBSEKBFMFL-CCWVLBSLSA-N |
| XLogP | 4.40 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|