C21H17N5O4S — CID 98118446
3-[[(4R)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid (PubChem CID 98118446) has the molecular formula C21H17N5O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is 3-[[(4R)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid.
| Compound Name | 3-[[(4R)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 98118446 |
| Molecular Formula | C21H17N5O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 3-[[(4R)-1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid |
| SMILES | COc1ccc(-c2csc(N3N=C(C)[C@@H](/N=N/c4cccc(C(=O)O)c4)C3=O)n2)cc1 |
| InChI | InChI=1S/C21H17N5O4S/c1-12-18(24-23-15-5-3-4-14(10-15)20(28)29)19(27)26(25-12)21-22-17(11-31-21)13-6-8-16(30-2)9-7-13/h3-11,18H,1-2H3,(H,28,29)/b24-23+/t18-/m1/s1 |
| InChIKey | IMWHIQLZTOQPKD-IUBFCHALSA-N |
| XLogP | 4.39 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|