C20H16N6O4S — CID 98119086
(4R)-4-[(3-methoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one (PubChem CID 98119086) has the molecular formula C20H16N6O4S and a molecular weight of 436.45 g/mol. Its IUPAC name is (4R)-4-[(3-methoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one.
| Compound Name | (4R)-4-[(3-methoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 98119086 |
| Molecular Formula | C20H16N6O4S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (4R)-4-[(3-methoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one |
| SMILES | COc1cccc(/N=N/[C@H]2C(=O)N(c3nc(-c4cccc([N+](=O)[O-])c4)cs3)N=C2C)c1 |
| InChI | InChI=1S/C20H16N6O4S/c1-12-18(23-22-14-6-4-8-16(10-14)30-2)19(27)25(24-12)20-21-17(11-31-20)13-5-3-7-15(9-13)26(28)29/h3-11,18H,1-2H3/b23-22+/t18-/m1/s1 |
| InChIKey | ZEMWZFFQPVRDLP-KGNHYALCSA-N |
| XLogP | 4.60 |
| TPSA | 122.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|