C21H18N6O4S — CID 98119105
(4S)-4-[(2-ethoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one (PubChem CID 98119105) has the molecular formula C21H18N6O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is (4S)-4-[(2-ethoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one.
| Compound Name | (4S)-4-[(2-ethoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 98119105 |
| Molecular Formula | C21H18N6O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (4S)-4-[(2-ethoxyphenyl)diazenyl]-5-methyl-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4H-pyrazol-3-one |
| SMILES | CCOc1ccccc1/N=N/[C@@H]1C(=O)N(c2nc(-c3cccc([N+](=O)[O-])c3)cs2)N=C1C |
| InChI | InChI=1S/C21H18N6O4S/c1-3-31-18-10-5-4-9-16(18)23-24-19-13(2)25-26(20(19)28)21-22-17(12-32-21)14-7-6-8-15(11-14)27(29)30/h4-12,19H,3H2,1-2H3/b24-23+/t19-/m0/s1 |
| InChIKey | MMUQGXVOCDZLPM-SMIQVMJNSA-N |
| XLogP | 4.99 |
| TPSA | 122.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|