C20H17N5O5S2 — CID 3101570
4-[[1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzenesulfonic acid (PubChem CID 3101570) has the molecular formula C20H17N5O5S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is 4-[[1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 3101570 |
| Molecular Formula | C20H17N5O5S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-[[1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzenesulfonic acid |
| SMILES | COc1ccc(-c2csc(N3N=C(C)C(/N=N/c4ccc(S(=O)(=O)O)cc4)C3=O)n2)cc1 |
| InChI | InChI=1S/C20H17N5O5S2/c1-12-18(23-22-14-5-9-16(10-6-14)32(27,28)29)19(26)25(24-12)20-21-17(11-31-20)13-3-7-15(30-2)8-4-13/h3-11,18H,1-2H3,(H,27,28,29)/b23-22+ |
| InChIKey | XIRKDQJUSOVWBL-GHVJWSGMSA-N |
| XLogP | 3.94 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|