C27H20ClN5O3S — CID 3106438
4-[(2-benzoyl-4-chlorophenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one (PubChem CID 3106438) has the molecular formula C27H20ClN5O3S and a molecular weight of 530.01 g/mol. Its IUPAC name is 4-[(2-benzoyl-4-chlorophenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one.
| Compound Name | 4-[(2-benzoyl-4-chlorophenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 3106438 |
| Molecular Formula | C27H20ClN5O3S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 4-[(2-benzoyl-4-chlorophenyl)diazenyl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-methyl-4H-pyrazol-3-one |
| SMILES | COc1ccc(-c2csc(N3N=C(C)C(/N=N/c4ccc(Cl)cc4C(=O)c4ccccc4)C3=O)n2)cc1 |
| InChI | InChI=1S/C27H20ClN5O3S/c1-16-24(31-30-22-13-10-19(28)14-21(22)25(34)18-6-4-3-5-7-18)26(35)33(32-16)27-29-23(15-37-27)17-8-11-20(36-2)12-9-17/h3-15,24H,1-2H3/b31-30+ |
| InChIKey | RFQVJOJWZRZSMN-NVQSTNCTSA-N |
| XLogP | 6.58 |
| TPSA | 96.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|