C18H14ClN5O2S — CID 98212672
(4R)-4-[(2-benzoyl-4-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide (PubChem CID 98212672) has the molecular formula C18H14ClN5O2S and a molecular weight of 399.86 g/mol. Its IUPAC name is (4R)-4-[(2-benzoyl-4-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide.
| Compound Name | (4R)-4-[(2-benzoyl-4-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 98212672 |
| Molecular Formula | C18H14ClN5O2S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | (4R)-4-[(2-benzoyl-4-chlorophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide |
| SMILES | CC1=NN(C(N)=S)C(=O)[C@@H]1/N=N/c1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14ClN5O2S/c1-10-15(17(26)24(23-10)18(20)27)22-21-14-8-7-12(19)9-13(14)16(25)11-5-3-2-4-6-11/h2-9,15H,1H3,(H2,20,27)/b22-21+/t15-/m1/s1 |
| InChIKey | NBPGYRSGZIZIQM-UCMDFWOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|