C11H8Cl2N6O3S — CID 3106497
4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide (PubChem CID 3106497) has the molecular formula C11H8Cl2N6O3S and a molecular weight of 375.20 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide.
| Compound Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 3106497 |
| Molecular Formula | C11H8Cl2N6O3S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carbothioamide |
| SMILES | CC1=NN(C(N)=S)C(=O)C1/N=N/c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H8Cl2N6O3S/c1-4-8(10(20)18(17-4)11(14)23)15-16-9-6(12)2-5(19(21)22)3-7(9)13/h2-3,8H,1H3,(H2,14,23)/b16-15+ |
| InChIKey | KOAXTNKKEUXCCW-FOCLMDBBSA-N |
| XLogP | 2.82 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|