C12H12N6O3 — CID 98119033
(4S)-4-[(4-carbamoylphenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carboxamide (PubChem CID 98119033) has the molecular formula C12H12N6O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is (4S)-4-[(4-carbamoylphenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carboxamide.
| Compound Name | (4S)-4-[(4-carbamoylphenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 98119033 |
| Molecular Formula | C12H12N6O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (4S)-4-[(4-carbamoylphenyl)diazenyl]-3-methyl-5-oxo-4H-pyrazole-1-carboxamide |
| SMILES | CC1=NN(C(N)=O)C(=O)[C@H]1/N=N/c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C12H12N6O3/c1-6-9(11(20)18(17-6)12(14)21)16-15-8-4-2-7(3-5-8)10(13)19/h2-5,9H,1H3,(H2,13,19)(H2,14,21)/b16-15+/t9-/m0/s1 |
| InChIKey | DTSCXBWRUIMYCT-FZQCLQRZSA-N |
| XLogP | 0.53 |
| TPSA | 143.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|