C21H17N7O4S — CID 46226710
4-[(1-benzoyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 46226710) has the molecular formula C21H17N7O4S and a molecular weight of 463.48 g/mol. Its IUPAC name is 4-[(1-benzoyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 4-[(1-benzoyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 46226710 |
| Molecular Formula | C21H17N7O4S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 4-[(1-benzoyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | CC1=NN(C(=O)c2ccccc2)C(=O)C1/N=N/c1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C21H17N7O4S/c1-14-18(20(30)28(26-14)19(29)15-6-3-2-4-7-15)25-24-16-8-10-17(11-9-16)33(31,32)27-21-22-12-5-13-23-21/h2-13,18H,1H3,(H,22,23,27)/b25-24+ |
| InChIKey | VPHQWEXBHGIBGV-OCOZRVBESA-N |
| XLogP | 2.79 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|