C23H21N7O5S — CID 98097952
ethyl (4S)-4-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]diazenyl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxylate (PubChem CID 98097952) has the molecular formula C23H21N7O5S and a molecular weight of 507.53 g/mol. Its IUPAC name is ethyl (4S)-4-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]diazenyl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxylate.
| Compound Name | ethyl (4S)-4-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]diazenyl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 98097952 |
| Molecular Formula | C23H21N7O5S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | ethyl (4S)-4-[[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]diazenyl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)C(=O)[C@H]1/N=N/c1ccc(S(=O)(=O)Nc2nccc(C)n2)cc1 |
| InChI | InChI=1S/C23H21N7O5S/c1-3-35-22(32)20-19(21(31)30(28-20)17-7-5-4-6-8-17)27-26-16-9-11-18(12-10-16)36(33,34)29-23-24-14-13-15(2)25-23/h4-14,19H,3H2,1-2H3,(H,24,25,29)/b27-26+/t19-/m0/s1 |
| InChIKey | VJYGAMUOGKTXIL-SVPNMLMASA-N |
| XLogP | 3.00 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|