C16H12AlN4O9S2 — CID 56843209
Acid Yellow 23 Aluminium lake (PubChem CID 56843209) has the molecular formula C16H12AlN4O9S2 and a molecular weight of 495.41 g/mol.
| Compound Name | Acid Yellow 23 Aluminium lake |
|---|---|
| PubChem CID | 56843209 |
| Molecular Formula | C16H12AlN4O9S2 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | — |
| SMILES | O=C(O)C1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1/N=N/c1ccc(S(=O)(=O)O)cc1.[Al] |
| InChI | InChI=1S/C16H12N4O9S2.Al/c21-15-13(18-17-9-1-5-11(6-2-9)30(24,25)26)14(16(22)23)19-20(15)10-3-7-12(8-4-10)31(27,28)29;/h1-8,13H,(H,22,23)(H,24,25,26)(H,27,28,29);/b18-17+; |
| InChIKey | PBHOALFJUHNTNW-ZAGWXBKKSA-N |
| XLogP | 0.74 |
| TPSA | 203.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|