C10H10N3O6S+ — CID 143578396
[3-carboxy-5-oxo-1-(4-sulfophenyl)-4H-pyrazol-4-yl]azanium (PubChem CID 143578396) has the molecular formula C10H10N3O6S+ and a molecular weight of 300.27 g/mol. Its IUPAC name is [3-carboxy-5-oxo-1-(4-sulfophenyl)-4H-pyrazol-4-yl]azanium.
| Compound Name | [3-carboxy-5-oxo-1-(4-sulfophenyl)-4H-pyrazol-4-yl]azanium |
|---|---|
| PubChem CID | 143578396 |
| Molecular Formula | C10H10N3O6S+ |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | [3-carboxy-5-oxo-1-(4-sulfophenyl)-4H-pyrazol-4-yl]azanium |
| SMILES | [NH3+]C1C(=O)N(c2ccc(S(=O)(=O)O)cc2)N=C1C(=O)O |
| InChI | InChI=1S/C10H9N3O6S/c11-7-8(10(15)16)12-13(9(7)14)5-1-3-6(4-2-5)20(17,18)19/h1-4,7H,11H2,(H,15,16)(H,17,18,19)/p+1 |
| InChIKey | VBKMDGXBOWYWHE-UHFFFAOYSA-O |
| XLogP | -1.67 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|