C16H12N4O3 — CID 88641283
5-oxo-1-phenyl-4-phenyldiazenyl-4H-pyrazole-3-carboxylic acid (PubChem CID 88641283) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 5-oxo-1-phenyl-4-phenyldiazenyl-4H-pyrazole-3-carboxylic acid.
| Compound Name | 5-oxo-1-phenyl-4-phenyldiazenyl-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 88641283 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-oxo-1-phenyl-4-phenyldiazenyl-4H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(c2ccccc2)C(=O)C1/N=N/c1ccccc1 |
| InChI | InChI=1S/C16H12N4O3/c21-15-13(18-17-11-7-3-1-4-8-11)14(16(22)23)19-20(15)12-9-5-2-6-10-12/h1-10,13H,(H,22,23)/b18-17+ |
| InChIKey | DLIIRTOELUQLPA-ISLYRVAYSA-N |
| XLogP | 2.63 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|