C16H12N4O9S2 — CID 3731972
5-oxo-1-(2-sulfophenyl)-4-[(2-sulfophenyl)diazenyl]-4H-pyrazole-3-carboxylic acid (PubChem CID 3731972) has the molecular formula C16H12N4O9S2 and a molecular weight of 468.43 g/mol. Its IUPAC name is 5-oxo-1-(2-sulfophenyl)-4-[(2-sulfophenyl)diazenyl]-4H-pyrazole-3-carboxylic acid.
| Compound Name | 5-oxo-1-(2-sulfophenyl)-4-[(2-sulfophenyl)diazenyl]-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 3731972 |
| Molecular Formula | C16H12N4O9S2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 5-oxo-1-(2-sulfophenyl)-4-[(2-sulfophenyl)diazenyl]-4H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(c2ccccc2S(=O)(=O)O)C(=O)C1/N=N/c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C16H12N4O9S2/c21-15-13(18-17-9-5-1-3-7-11(9)30(24,25)26)14(16(22)23)19-20(15)10-6-2-4-8-12(10)31(27,28)29/h1-8,13H,(H,22,23)(H,24,25,26)(H,27,28,29)/b18-17+ |
| InChIKey | AYEVOOKBKXPJTQ-ISLYRVAYSA-N |
| XLogP | 1.12 |
| TPSA | 203.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|