C20H14N4O15S4 — CID 89201057
5-oxo-1-(4-sulfophenyl)-4-[(3,6,8-trisulfonaphthalen-2-yl)diazenyl]-4H-pyrazole-3-carboxylic acid (PubChem CID 89201057) has the molecular formula C20H14N4O15S4 and a molecular weight of 678.61 g/mol. Its IUPAC name is 5-oxo-1-(4-sulfophenyl)-4-[(3,6,8-trisulfonaphthalen-2-yl)diazenyl]-4H-pyrazole-3-carboxylic acid.
| Compound Name | 5-oxo-1-(4-sulfophenyl)-4-[(3,6,8-trisulfonaphthalen-2-yl)diazenyl]-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 89201057 |
| Molecular Formula | C20H14N4O15S4 |
| Molecular Weight | 678.61 g/mol |
| Exact Mass | 677.93 |
| IUPAC Name | 5-oxo-1-(4-sulfophenyl)-4-[(3,6,8-trisulfonaphthalen-2-yl)diazenyl]-4H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1/N=N/c1cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C20H14N4O15S4/c25-19-17(18(20(26)27)23-24(19)10-1-3-11(4-2-10)40(28,29)30)22-21-14-8-13-9(6-16(14)43(37,38)39)5-12(41(31,32)33)7-15(13)42(34,35)36/h1-8,17H,(H,26,27)(H,28,29,30)(H,31,32,33)(H,34,35,36)(H,37,38,39)/b22-21+ |
| InChIKey | BTLDMKRPENICLG-QURGRASLSA-N |
| XLogP | 0.77 |
| TPSA | 312.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.61 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|