C40H29N9Na2O9S — CID 170843264
CID 170843264 (PubChem CID 170843264) has the molecular formula C40H29N9Na2O9S and a molecular weight of 857.77 g/mol.
| Compound Name | CID 170843264 |
|---|---|
| PubChem CID | 170843264 |
| Molecular Formula | C40H29N9Na2O9S |
| Molecular Weight | 857.77 g/mol |
| Exact Mass | 857.16 |
| IUPAC Name | — |
| SMILES | Nc1ccc(/C(O)=N/c2ccc3c(O)c(/N=N/c4ccc(/C(O)=N/c5ccc(/N=N/C6C(=O)N(c7ccccc7)N=C6C(=O)O)cc5)cc4)c(S(=O)(=O)O)cc3c2)cc1.[Na].[Na] |
| InChI | InChI=1S/C40H29N9O9S.2Na/c41-25-10-6-22(7-11-25)38(52)43-29-18-19-31-24(20-29)21-32(59(56,57)58)33(36(31)50)46-44-27-12-8-23(9-13-27)37(51)42-26-14-16-28(17-15-26)45-47-34-35(40(54)55)48-49(39(34)53)30-4-2-1-3-5-30;;/h1-21,34,50H,41H2,(H,42,51)(H,43,52)(H,54,55)(H,56,57,58);;/b46-44+,47-45+;; |
| InChIKey | GNMJRWDAXHFOPS-MKXWKNNCSA-N |
| XLogP | 7.24 |
| TPSA | 285.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.77 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|