C42H32N6O10S2 — CID 136825532
1-N,4-N-bis[5-hydroxy-6-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-2-yl]benzene-1,4-dicarboximidic acid (PubChem CID 136825532) has the molecular formula C42H32N6O10S2 and a molecular weight of 844.88 g/mol. Its IUPAC name is 1-N,4-N-bis[5-hydroxy-6-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-2-yl]benzene-1,4-dicarboximidic acid.
| Compound Name | 1-N,4-N-bis[5-hydroxy-6-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-2-yl]benzene-1,4-dicarboximidic acid |
|---|---|
| PubChem CID | 136825532 |
| Molecular Formula | C42H32N6O10S2 |
| Molecular Weight | 844.88 g/mol |
| Exact Mass | 844.16 |
| IUPAC Name | 1-N,4-N-bis[5-hydroxy-6-[(4-methylphenyl)diazenyl]-7-sulfonaphthalen-2-yl]benzene-1,4-dicarboximidic acid |
| SMILES | Cc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(/N=C(\O)c4ccc(/C(O)=N/c5ccc6c(O)c(/N=N/c7ccc(C)cc7)c(S(=O)(=O)O)cc6c5)cc4)ccc3c2O)cc1 |
| InChI | InChI=1S/C42H32N6O10S2/c1-23-3-11-29(12-4-23)45-47-37-35(59(53,54)55)21-27-19-31(15-17-33(27)39(37)49)43-41(51)25-7-9-26(10-8-25)42(52)44-32-16-18-34-28(20-32)22-36(60(56,57)58)38(40(34)50)48-46-30-13-5-24(2)6-14-30/h3-22,49-50H,1-2H3,(H,43,51)(H,44,52)(H,53,54,55)(H,56,57,58)/b47-45+,48-46+ |
| InChIKey | LUEVCBOYEHEWMN-MLGMXDONSA-N |
| XLogP | 10.62 |
| TPSA | 263.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.88 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|