C17H15N5O9S2 — CID 20741796
4-[[5-(methylamino)-2-sulfophenyl]diazenyl]-5-oxo-1-(4-sulfophenyl)-4H-pyrazole-3-carboxylic acid (PubChem CID 20741796) has the molecular formula C17H15N5O9S2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 4-[[5-(methylamino)-2-sulfophenyl]diazenyl]-5-oxo-1-(4-sulfophenyl)-4H-pyrazole-3-carboxylic acid.
| Compound Name | 4-[[5-(methylamino)-2-sulfophenyl]diazenyl]-5-oxo-1-(4-sulfophenyl)-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 20741796 |
| Molecular Formula | C17H15N5O9S2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 4-[[5-(methylamino)-2-sulfophenyl]diazenyl]-5-oxo-1-(4-sulfophenyl)-4H-pyrazole-3-carboxylic acid |
| SMILES | CNc1ccc(S(=O)(=O)O)c(/N=N/C2C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C(=O)O)c1 |
| InChI | InChI=1S/C17H15N5O9S2/c1-18-9-2-7-13(33(29,30)31)12(8-9)19-20-14-15(17(24)25)21-22(16(14)23)10-3-5-11(6-4-10)32(26,27)28/h2-8,14,18H,1H3,(H,24,25)(H,26,27,28)(H,29,30,31)/b20-19+ |
| InChIKey | CHSJNKPFPQYULN-FMQUCBEESA-N |
| XLogP | 1.16 |
| TPSA | 215.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|