C24H21Cl2N5O6S2 — CID 23618993
2,5-dichloro-4-[4-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid (PubChem CID 23618993) has the molecular formula C24H21Cl2N5O6S2 and a molecular weight of 610.50 g/mol. Its IUPAC name is 2,5-dichloro-4-[4-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 2,5-dichloro-4-[4-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 23618993 |
| Molecular Formula | C24H21Cl2N5O6S2 |
| Molecular Weight | 610.50 g/mol |
| Exact Mass | 609.03 |
| IUPAC Name | 2,5-dichloro-4-[4-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccccc1/N=N/C1C(=O)N(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)N=C1C |
| InChI | InChI=1S/C24H21Cl2N5O6S2/c1-3-30(16-9-5-4-6-10-16)38(33,34)21-12-8-7-11-19(21)27-28-23-15(2)29-31(24(23)32)20-13-18(26)22(14-17(20)25)39(35,36)37/h4-14,23H,3H2,1-2H3,(H,35,36,37)/b28-27+ |
| InChIKey | VUKHFOZWTASXCH-BYYHNAKLSA-N |
| XLogP | 5.33 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|