C16H12ClN4O5S- — CID 171157414
5-chloro-2-hydroxy-3-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]benzenesulfonate (PubChem CID 171157414) has the molecular formula C16H12ClN4O5S- and a molecular weight of 407.82 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-3-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]benzenesulfonate.
| Compound Name | 5-chloro-2-hydroxy-3-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 171157414 |
| Molecular Formula | C16H12ClN4O5S- |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 5-chloro-2-hydroxy-3-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]benzenesulfonate |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1/N=N/c1cc(Cl)cc(S(=O)(=O)[O-])c1O |
| InChI | InChI=1S/C16H13ClN4O5S/c1-9-14(16(23)21(20-9)11-5-3-2-4-6-11)19-18-12-7-10(17)8-13(15(12)22)27(24,25)26/h2-8,14,22H,1H3,(H,24,25,26)/p-1/b19-18+ |
| InChIKey | LSFNRVBPDLEXDS-VHEBQXMUSA-M |
| XLogP | 2.82 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|