C16H13BaN4O4S+ — CID 21124835
barium(2+);4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonate (PubChem CID 21124835) has the molecular formula C16H13BaN4O4S+ and a molecular weight of 494.70 g/mol. Its IUPAC name is barium(2+);4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonate.
| Compound Name | barium(2+);4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 21124835 |
| Molecular Formula | C16H13BaN4O4S+ |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | barium(2+);4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonate |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)[O-])cc2)C(=O)C1/N=N/c1ccccc1.[Ba+2] |
| InChI | InChI=1S/C16H14N4O4S.Ba/c1-11-15(18-17-12-5-3-2-4-6-12)16(21)20(19-11)13-7-9-14(10-8-13)25(22,23)24;/h2-10,15H,1H3,(H,22,23,24);/q;+2/p-1/b18-17+; |
| InChIKey | SXLLKBPAJOVDCK-ZAGWXBKKSA-M |
| XLogP | 2.08 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|