C17H16N4O3S — CID 98285017
(4R)-5-methyl-4-[(4-methylsulfonylphenyl)diazenyl]-2-phenyl-4H-pyrazol-3-one (PubChem CID 98285017) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is (4R)-5-methyl-4-[(4-methylsulfonylphenyl)diazenyl]-2-phenyl-4H-pyrazol-3-one.
| Compound Name | (4R)-5-methyl-4-[(4-methylsulfonylphenyl)diazenyl]-2-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 98285017 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (4R)-5-methyl-4-[(4-methylsulfonylphenyl)diazenyl]-2-phenyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@@H]1/N=N/c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-12-16(17(22)21(20-12)14-6-4-3-5-7-14)19-18-13-8-10-15(11-9-13)25(2,23)24/h3-11,16H,1-2H3/b19-18+/t16-/m1/s1 |
| InChIKey | CYHVMRXVVMYOOD-VRTBNJGNSA-N |
| XLogP | 2.97 |
| TPSA | 91.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|