C24H19N5O7S — CID 99116533
2-[(2-carboxyphenyl)sulfamoyl]-5-[[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]diazenyl]benzoic acid (PubChem CID 99116533) has the molecular formula C24H19N5O7S and a molecular weight of 521.51 g/mol. Its IUPAC name is 2-[(2-carboxyphenyl)sulfamoyl]-5-[[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]diazenyl]benzoic acid.
| Compound Name | 2-[(2-carboxyphenyl)sulfamoyl]-5-[[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 99116533 |
| Molecular Formula | C24H19N5O7S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 2-[(2-carboxyphenyl)sulfamoyl]-5-[[(4S)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]diazenyl]benzoic acid |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@H]1/N=N/c1ccc(S(=O)(=O)Nc2ccccc2C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H19N5O7S/c1-14-21(22(30)29(27-14)16-7-3-2-4-8-16)26-25-15-11-12-20(18(13-15)24(33)34)37(35,36)28-19-10-6-5-9-17(19)23(31)32/h2-13,21,28H,1H3,(H,31,32)(H,33,34)/b26-25+/t21-/m0/s1 |
| InChIKey | BXHJDVXJHWGGDE-WHEOYJBGSA-N |
| XLogP | 3.76 |
| TPSA | 178.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|