C25H25N5O6S2 — CID 21124510
4-[4-[[3-[(2-ethylphenyl)sulfamoyl]-4-methylphenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid (PubChem CID 21124510) has the molecular formula C25H25N5O6S2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 4-[4-[[3-[(2-ethylphenyl)sulfamoyl]-4-methylphenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 4-[4-[[3-[(2-ethylphenyl)sulfamoyl]-4-methylphenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21124510 |
| Molecular Formula | C25H25N5O6S2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 4-[4-[[3-[(2-ethylphenyl)sulfamoyl]-4-methylphenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
| SMILES | CCc1ccccc1NS(=O)(=O)c1cc(/N=N/C2C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C)ccc1C |
| InChI | InChI=1S/C25H25N5O6S2/c1-4-18-7-5-6-8-22(18)29-37(32,33)23-15-19(10-9-16(23)2)26-27-24-17(3)28-30(25(24)31)20-11-13-21(14-12-20)38(34,35)36/h5-15,24,29H,4H2,1-3H3,(H,34,35,36)/b27-26+ |
| InChIKey | PLZXYBITHMGYNV-CYYJNZCTSA-N |
| XLogP | 4.48 |
| TPSA | 157.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|