C24H19Cl2N5O8S2 — CID 129405975
2-[[5-[[(4S)-1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-methylphenyl]sulfonylamino]benzoic acid (PubChem CID 129405975) has the molecular formula C24H19Cl2N5O8S2 and a molecular weight of 640.48 g/mol. Its IUPAC name is 2-[[5-[[(4S)-1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-methylphenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[5-[[(4S)-1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-methylphenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 129405975 |
| Molecular Formula | C24H19Cl2N5O8S2 |
| Molecular Weight | 640.48 g/mol |
| Exact Mass | 639.01 |
| IUPAC Name | 2-[[5-[[(4S)-1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-methylphenyl]sulfonylamino]benzoic acid |
| SMILES | CC1=NN(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)C(=O)[C@H]1/N=N/c1ccc(C)c(S(=O)(=O)Nc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C24H19Cl2N5O8S2/c1-12-7-8-14(9-20(12)40(35,36)30-18-6-4-3-5-15(18)24(33)34)27-28-22-13(2)29-31(23(22)32)19-10-17(26)21(11-16(19)25)41(37,38)39/h3-11,22,30H,1-2H3,(H,33,34)(H,37,38,39)/b28-27+/t22-/m0/s1 |
| InChIKey | IFZDZRJOKUHLMJ-XJPNONJMSA-N |
| XLogP | 4.92 |
| TPSA | 195.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|